Главная Обратная связь

Дисциплины:

Архитектура (936)
Биология (6393)
География (744)
История (25)
Компьютеры (1497)
Кулинария (2184)
Культура (3938)
Литература (5778)
Математика (5918)
Медицина (9278)
Механика (2776)
Образование (13883)
Политика (26404)
Правоведение (321)
Психология (56518)
Религия (1833)
Социология (23400)
Спорт (2350)
Строительство (17942)
Технология (5741)
Транспорт (14634)
Физика (1043)
Философия (440)
Финансы (17336)
Химия (4931)
Экология (6055)
Экономика (9200)
Электроника (7621)






Задачи для самостоятельного решения. 1. Определить, какой из металлов – кальций или железо – лучше взаимодействует с разбавленной соляной кислотой



1. Определить, какой из металлов – кальций или железо – лучше взаимодействует с разбавленной соляной кислотой.

2. Будет ли протекать реакция при взаимодействии растворов FeSO4 и HgSO4?

3. Чему равен электродный потенциал олова, опущенный в раствор его соли с активностью ионов Sn2+, равной 0,001 моль/литр?

4. Выяснить, окислится ли Cr3+ в Cr2O72- анионом (S2O8)2- с восстановлением его в SO42-.

5. Выяснить, окислится ли ион Cr3+ в Cr2O72- анионом NO3- с восстановлением последнего до NO.

6. Может ли перманганат калия KMnO4 окислить в кислой среде хлорид олова(II), если концентрации их ионов в растворе равны1г-ион/л?

7. Перманганат калия можно получить окислением манганата (K2MnO4) например, хлором. Можно ли вместо хлора применить бром или йод?

 

 

6. Механизмы некоторых реакций

окисления-восстановления

 

Скорость химической реакции зависит от механизма ее и колеблется в самых широких пределах.

Под механизмом реакций понимают ряд стадий, через которые проходят исходные вещества, чтобы превратиться в конечные продукты, т.е. это путь, по которому протекает реакция:

исходные вещества — промежуточные продукты — конечные вещества.

Выявление среднего звена (промежуточных продуктов), раскрывающего механизм процесса и не представляющего никакого интереса с точки зрения вычисления G0 процесса, обычно является очень сложной проблемой, т. к. промежуточные продукты выделить и изучить удается очень редко.

Многочисленными исследованиями российских и иностранных ученых (Н.Н. Семенов, Н.М. Эмануэль, А.Н Теренин, В.Н. Кондратьев, Райс, Уотерс и многие другие) доказано, что многие химические реакции протекают через промежуточное образование нестойких свободных радикалов. Такие радикалы обладают свободными валентностями, т.е. неспаренными, «холостыми» электронами, и отличаются высокой реакционной способностью. Для того, чтобы представить механизм реакции, необходимо знать строение реагирующих молекул на протяжении всей реакции. Следует также знать природу взаимодействия (образования связей) между атомами, влияние условий среды, энергию системы на всех стадиях и скорость, с которой во время реакции происходят различные изменения.

Зная механизм химического превращения, можно научиться получать необходимые вещества кратчайшим путем (Эмануэль Н.М. Химическая кинетика. –М.: Знание, 1966).

Реакции могут быть быстрыми и медленными. Мы часто вмешиваемся в их протекание, чтобы ускорить одну из них, а другие - замедлить. Изучают механизмы реакций с целью:



1) рационального выбора методов синтеза различных веществ;

2) научиться управлять ими так, чтобы обеспечить наибольшую скорость реакции.

Приведем механизмы некоторых окислительно-восстановительных реакций (Терни Т. Механизмы реакций окисления-восстановления. –М.: Мир, 1968).

Пример 1

Реакция окисления газообразного бромида водорода кислородом протекает с заметной скоростью при температуре 400-600°С:

4НВr(г) + 02(г) = 2Вr2(г) +2Н2О(г) (6.1)

В суммарной реакции участвуют пять молекул — четыре молекулы бромида водорода и одна молекула кислорода. Но вероятность одновременного столкновения пяти молекул в газовой фазе практически равна нулю. Следовательно, эта реакция должна протекать через ряд более простых стадий. Предполагается, что реакция (6.1) протекает через следующие промежуточные стадии:

НВr+02 = НООВr, медленная стадия (6.2)

НООВr+НВr = 2НОВr, быстрая стадия(6.3)

НОВr+НВr = Вr22О, быстрая стадия(6.4)

Анализируя написанные стадии, мы видим, что сложение реакций (6.2) и (6.3) и удвоенной реакции (6.4) дает суммарную реакцию (6.1). Затем мы замечаем, что в каждой из промежуточных стадий (6.2), (6.3) и (6.4) участвуют только две молекулы. Стадия (6.2) определяет скорость всей реакции, так как с какой скоростью образуется HOOBr, с такой же скоростью это соединение вступает в реакцию (6.3). Независимо от скорости реакции (6.3) и (6.4) бром и вода могут получаться в результате этих реакций только со скоростью, равной скорости стадии (6.2), которая является самой медленной из всех.

Таким образом, факторы, определяющие скорость реакции (6.2), определяют скорость процесса в целом. Ряд стадий (6.2), (6.3) и (6.4) называют механизмом суммарной реакции (6.1). Реакция (6.2) называется стадией, определяющей скорость суммарной реакции.



Пример 2

Реакция 2HJ + H2O2 = J2 + 2H2O

Судя по этой записи, она является трехмолекулярной. Или в ионном виде:

(6.5)

Мы уже отмечали, что вероятность одновременного столкновения пяти частиц (в данном случае двух ионов J¯, одной молекулы Н2О2 и двух ионов H+) практически равна нулю. Следовательно, и эта реакция должна протекать через ряд более простых стадий. Экспериментально установлено, что в одной из промежуточных стадий ее происходит образование аниона йодноватистой кислоты по уравнению

медленная стадия (6.5.1)

Далее быстрая (6.5.2)

HJO + J¯ +H+ = J2 + H2O быстрая (6.5.3)

Почленно складывая стадии (6.5.1), (6.5.2) и (6.5.3), получим суммарное уравнение реакции (6.5). Очевидно скорость этой сложной реакции определяется скоростью наиболее медленно протекающей промежуточной стадии ее. Наиболее медленной стадией рассматриваемой окислительно-восстановительной реакции является стадия (6.5.1). Скорость протекания стадии (6.5.1) определяет скорость всего процесса, подобно тому, как скорость самой продолжительной операции на конвейере определяет скорость движения его.

Пример 3. Окисление ионов двухвалентного железа молекулярным кислородом в кислой среде выражают уравнением

4Fе2++02+4Н+ =4Fез++2H2O (6.6)

На самом деле этот процесс не может протекать путем прямого взаимодействия указанных веществ. Во-первых, вероятность одновременного столкновения девяти частиц является практически невозможной. Во-вторых, из десяти частиц восемь несут положительные заряды, которые будут отталкиваться. По современным представлениям этот процесс идет через следующие стадии:

1) (6.6.1)

2) (6.6.2)

3) (6.6.3)

4) (6.6.4)

5) (6.6.5)

6) (6.6.6)

7) (6.6.7)

Этот путь, несмотря на свою сложность, является неизмери­мо более выгодным, так как из семи стадий каждая включает двойные столкновения, кроме того, ни в одной из стадий не требуется взаимодействия одноименно заряженных частиц. В этом примере свободные радикалы и , ионы , содержащие неспаренные электроны, и молекула H202 являются реакционноспособными промежуточными веществами. Они образуются в одних стадиях процесса и расходуются в других.

 

7. тестовый промежу­точной контроль по теме овр

№1

Задание Степень окисления кислорода в соединении СаО2.

Ответы: l) -2; 2) -l; 3) 0; 4) +2; 5) +l.

 

№ 2

Задание: Степень окисления хлора +7 в соединении:

Ответы: 1) HClO; 2) HClO2; 3) NaClO3; 4) КClO4; 5) Cl2О5.

 

№ 3

Задание: Степень окисления серы +6 в соединении:

Ответы: 1) (NH4)2S2O8 s; 2) K2S4O6 3) (NH4)2SO3; 4) A12S3; 5) SO2.

 

№ 4

Задание: Постоянную степень окисления в реакциях проявляет элемент:

Ответы: 1) Сl2; 2) Мn; 3) Са; 4) S; 5) Сu.

 

№ 5

Задание: Переменную степень окисления в реакциях проявляет элемент:

Ответы: 1) N; 2) Li; 3) Fr; 4) Al; 5) Mg.

 

№ 6

Задание: Степень окисления марганца +6 в соединении:

Ответы: 1) КМпО4; 2) Мn2О7; 3) (NH4)2MnO4 4) КМnО4; 5) NH4MnO4.

 

№ 7

Задание: Окисление - это ... некоторого числа электронов (подберите правиль­ное слово). Число электронов в переходе: равно ...: Ответы: 1). 2; 2) 4; 3) 6; 4) 7; 5) 10.

 

№ 8

Задание: Восстановление это ... некоторого числа электронов (подберите пра­вильное слово). Число электронов в переходе: равно ...:

Ответы: 1) 4; 2) 5; 3) 8; 4) 7; 5) 9.

 

№ 9

Задание: В полуреакции: число принятых электронов равно

Ответы: 1) 10; 2) 8; 3) 12; 4) 14; 5) 9.

 

№ 10

Задание: В полуреакции: число отданных электронов равно

Ответы: 1) 6; 2) 8; 3) 7; 4) 9; 5) 3.

№ 11

Задание: Окисление - это ... степени окисления элемента (подберите правиль­ное слово). В полуреакции степень окисления ванадия стала равной:

Ответы: 1) 8; 2) 4; 3) 5; 4) 6; 5) 10.

 

№ 12

Задание: Восстановление - это ... степени окисления элемента (подберите пра­вильное слово). В полуреакции степень окисления мар­ганца стала равной:

Ответы: 1) 2; 2) 4; 3) 7; 4) 8; 5) 6.

 

№ 13

Задание: Только восстановителями в ОВР являются соединения:

Ответы: 1) Na2SnO3; 2) НIO4; 3) Na2S; 4) K2SO3; 5) Na3AsO4.

 

№ 14

Задание: Только окислителями в ОВР являются соединения:

Ответы: 1) NaBiO3; 2) H2SO3; 3) Н2О2; 4) MnSO4; 5) Al.

 

№ 15

Задание: Сумма коэффициентов перед окислителем и восстановителем в сле­дующей ОВР Аl+ K2Cr2O7+H2SO4 →A12(SO4)3+ Cr2(SO4)3+K2SO4+H2O равна:

Ответы: 1) 2; 2) 3; 3) 6; 4) 8; 5) 7.

 

№ 16

Задание: Сумма коэффициентов перед окислителем и восстановителем в сле­дующей ОВР равна:

Ответы: 1) 6; 2) 4; 3) 12; 4) 8; 5) 10.

 

№ 17

Задание: Сумма коэффициентов перед окислителем и восстановителем в сле­дующей ОВР NaClO3+SO2+H2SO4 → NaHSO4+ClO2 равна:

Ответы: 1) 3; 2) 6; 3) 8; 4) 10; 5) 12.

 

№ 18

Задание: Сумма коэффициентов перед окислителем и восстановителем в следующей ОВР Ca3(PO4)2 + C + SiO2 → P + CO + CaSiO3 равна:

Ответы: 1) 5; 2) 6; 3) 10; 4) 12; 5) 14.

 

№ 19

Задание: Коэффициент перед восстановителем в реакции

KMnO4+N2H4+H2SO4 → N2+ 4MnSO4+ K2SO4+H2O равен.

Ответы: 1) 5; 2) 7; 3) 8; 4) 10; 5) 9.

№ 20

Задание: Реакция диспропорционирования следующая:

1) 2КМnО4 → К2МnО4+ МnO22;

2) MgCl2+ H2O → MgOHCl+HCl;

3) 3Ag+4HNO3 → 3AgNO3+NO+2H2O;

4) 2Cr(OH)3+3H2SO4 →Cr2(SO4)3+6H2O;

5) NaOH+HCl → NaC1+H2O.

Ответы: 1); 2); 3); 4); 5).

 

№ 21

Задание: Реакция внутримолекулярного окисления-восстановления следующая:

1) 4Ag+H2S+O2 → 2Ag2S+2H2O;

2) 2CuI2 → 2CuI+I2;

3) 3K2MnO4+2H2O → 2KMnO4+MnO2+4KOH;

4) 6NaOH+3S → 2Na2S+Na2SO3+3H2O;

5) Cu+4HNO3 → Cu(NO3)2 +2NO2+2H2O.

Ответы:1); 2); 3); 4); 5).

 

№ 22

Задание: Реакция окисления-восстановления следующая:

1) Р2О5+3Н2О → 2Н3РО4;

2) КОН+А1(ОН)3 →КА1О2+2Н2О;

3) СаСО3→СаО+СО2;

4) SO3+H2O →H2SO4;

5) 2AgNO3 →2Ag +2NO2+O2.

Ответы:1); 2); 3); 4); 5).

 

№ 23

Задание: Окислительно-восстановительную двойственность проявляет следующая частица:

Ответы: 1) S–2; 2) MnO2; 3) NO3¯ ; 4) ;5) .

 

№ 24

Задание: Окислительно-восстановительную двойственность прояв­ляет следующая частица:

Ответы: 1) S–2; 2) MnO2; 3) NO3¯; 4) Mn2+; 5) MnO4¯.

 

№ 25

Задание: Окислительно-восстановительную двойственность в ОВР проявляет следующая частица:

1) NaNO2; 2) NaNO3; 3) NH4NO3; 4) КМnО4; 5) Al.

Ответы:1); 2); 3); 4); 5).

 

 

№ 26

Задание: Только окислительные свойства проявляет следующая частица:

1) (NH4)2S2O8; 2) Na2SO3; 3) K2MnO4; 4) A12(SO4)3; 5) HI.

Ответы:1); 2); 3); 4); 5).

 

№27

Задание Окислительно-восстановительная реакция следующая:

1) Sb+5HNO3+H2O → H[Sb(OH)6]+5NO2;

2) КОН+А1(ОН)3 → КАlO2+2Н2О;

3) Р2О5+ЗН2О → 2Н3РО4;

4) СrCl3+ЗН2О →Сr(ОН)3+ЗНС1;

5) NH3+H2O →NH4OH.

Ответы:1); 2); 3); 4); 5).

 

№ 28

Задание: Коэффициент перед восстановителем в реакции

Na2S2O3+I2 → Na2S4O6+NaI равен:

Ответы: 1) 2; 2) 4; 3) 3; 4) 6; 5) 3.

 

№ 29

Задание: Реакция диспропорционирования следующая:

1) 3Ag+4HNO3 →3AgNO3+NO+2H2O;

2) MgCl2+ H2O →MgOHCl+HCl;

3) 2КМnО4 → К2МnО4+ МnО2+О2;

4) Zn+2HCl → ZnCl2+H2

5) 2Cr(OH)3+3H2SO4 →Cr2(SO4)3+6H2O;

6) МnO2 +4НС1→МnС12+С12+2Н2О.

Ответы:1); 2); 3); 4); 5).

 

№ 30.

Задание: Сумма коэффициентов в уравнении реакции С12+КВr→КС1+Вr2 равна:

Ответы: 1) 4; 2) 6; 3) 7; 4) 9; 5) 10.

 

№ 31

Задание. Сумма коэффициентов в правой части уравнения реакции

HgCl2+H3PO3+H2O → H3PO4+Hg+HCl равна:

Ответы: 1) 3; 2) 6; 3) 7; 4) 9; 5) 10.

 

№ 32

Задание. Сумма коэффициентов в уравнении реакции

Sb+HNO3 → HSbO3 +NO+H2O равна:

Ответы: 1) 13; 2) 15; 3) 17; 4) 18; 5) 20.

 

 

№ 33

Задание: Сумма коэффициентов в уравнении реакции

Sn+HNO3 → H2SnO3+NO2+H2O равна:

α-оловянная кислота

Ответы: 1) 10; 2) 11; 3) 12; 4) 14; 5) 16.

 

№ 34

Задание: K2Cr2O7 в кислой среде при стандартных условиях окислитель только для следующего процесса:

1)

2)

3)

4)

5) .

Ответы: 1); 2); 3); 4); 5).

 

№ 35

Задание: K2Cr2O7 в кислой среде при стандартных условиях окислитель только для следующего процесса:

1)

2)

3)

4)

5) .

Ответы: 1); 2); 3); 4); 5).

 

№ 36

Задание: Окислительно-восстановительную реакцию направляет:

1) ;

2) ;

3) ;

4) ;

5) .

Ответы: 1); 2); 3); 4); 5).

 

№ 37

Задание: Окислительно-восстановительную реакцию направляет:

1) ;

2) ;

3) температура не изменяется;

4) давление нормальное (101,3 кПа)

5) концентрации окисленной и восстановленной формы не изменяются.

Ответы: 1); 2); 3); 4); 5).

 

№ 38

Задание: Сложные ионы и молекулы, содержащие атомы в состоянии промежу­точной степени окисления, проявляют:

1) только восстановительные свойства;

2) только окислительные свойства;

3) не проявляют свойств окислителя и восстановителя;

4) проявляют свойства окислителя и восстановителя;

5) кислотные свойства.

Ответы: 1); 2); 3); 4); 5).

 

№ 39

Задание: Большая величина константы равновесия ОВР показывает, что равно­весие смещено:

1) вправо; 2) влево; 3. концентрация восстановленной формы меньше концентрации окисленной формы; 4). скорость прямой реакции мень­ше скорости обратной; 5). скорость прямой реакции равна скорости обратной.

Ответы: 1); 2); 3); 4); 5).

 

№ 40

Задание: Масса щелочи, образуемая в результате реакции

Na2O2+H2O→NaOH +O2, равна:

0.5 моль избыток

Ответы: 1) 10 г; 2) 20 г; 3) 30 г; 4) 40 г; 5) 44 г.

 

№ 41

Задание: Масса серы, которая образуется в результате реакции

H2S+SO2 →S+H2O (н.у.), равна:

22,4 л избыток

Ответы: 1) 24 г; 2) 32 г; 3) 48 г; 4) 64 г; 5) 54 г.

 

№ 42

Задание: Масса йода, которая образуется в результате реакции

KI + Br2 → КВr+I2 , равна:

0,2 моль избыток

Ответы: 1) 12,7 г; 2) 2,4 г; 3) 9,8 г; 4) 101,6 г; 5) 19,6 г.

 

№ 43

Задание: Объем водорода (н.у.), который выделяется в результате реакции ВаН2 2О→Ва(ОН)22, равен:

0,5 моль избыток

Ответы: 1) 22,4 л; 2) 11,2 л; 3) 4,48 л; 4) 2,24 л; 5) 44,8 л.

 

№ 44

Задание: Окислительно-восстановительный потенциал системы ; j0SO42- /SO32- = 0,2 B

при следующих концентрациях моль/л: 10-3, 5·10-2, 2,9 равен:

Ответы:1) 0,19 В; 2) 0,38 В; 3) 0,22 В; 4) 0,4 В; 5) 0,18 В.

 

№ 45

Задание: Окислительно-восстановительный потенциал пары Мn2+/Мn при концентрации Мn2+ = 2 г-ион/л равен: .

Ответы: 1) -1,3В; 2) -1,247В 3) -2В; 4) -0,85В; 5) 1,2В.

 

№ 46

Задание: Окислительно-восстановительный потенциал пары Мn2+/Мn при концентрации Мn2+ = 0,005 моль/л равен: .

Ответы: 1) -1,3В; 2) -1,247В; 3) -1,02В; 4) -0,98В; 5) +0,1В.

 

№ 47

Задание: Окислительно-восстановительный потенциал пары при концентрации катионов водорода 10-5 г-ион/л равен:

Ответы.1) 1,046В; 2) 1,51В; 3) 1,48В; 4) 1,1В; 5) 1,08В.

 

№ 48

Задание. Окислительно-восстановительный потенциал для системы при условии =10-5 моль/л;

=10-2 моль/лравен:

Ответы: 1) 1,51В; 2) 1,49В; 3) 1,36В; 4) 1,409В; 5) 1,38В.

 

№ 49

Задание: Окислительно-восстановительная реакция

FeSO4+H2SO4+K2Cr2O7 →Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O возможна, если ∆φ° реакции ( ) равна:

Ответы: 1) 0,56В; 2) 0,62В; 3) 0,7В; 4) 0,8В; 5) 0,82В.

 

№ 50

Задание. Константа равновесия реакции 2HNO3+S = 2NO + H2SO4 при следую­щих условиях: Р=5,066104 Па;

равна:

Ответы: 1) 3,89·1059; 2) 3,60·1059; 3) 2,9·1029; 4) 3·1030; 5) 4·1059.

№ 51

Задание: Константа равновесия реакции

2КMnO4 +5НВr + 3H2SO4 =2MnSO4 +5HBrO + K2SO4 +ЗH2О для стан­дартных условий равна:

Ответы 1) 3,33·1029; 2) 3,22·1030; 3) 3,4·1030; 4) 3,5·1030; 5) 3,6·1029.

 

№ 52

Задание: Константа равновесия окислительно-восстановительной системы

при стандартных условиях равна:

Ответы: 1) 2,63·1075; 2) 2,7·1070; 3) 2,4·1075; 4) 2,6·1070; 5) 2,65·1070.

 

№ 53

Задание: Направление окислительно-восстановительной реакции при указан­ных условиях 2Со3+ + Рb2+ ↔ 2Со2+ + РЬ4+ будет протекать:

1·10-4 1·10-6 1·10-2 1·10-2

моль/л моль/л моль/л моль/л

1) справа налево; 2) слева направо; 3) реакция находится в равнове­сии; 4) реакция ионообменная; 5) преобладает скорость прямой ре­акции.

Ответы: 1); 2); 3); 4); 5).

 

№ 54

Задание: Сумма коэффициентов перед окислителем и восстановителем в следующей ОВР H2SO4 +HI→ H2S + I2 + H2O равна:

Ответы: 1) 9; 2) 3; 3) 6; 4) 8; 5) 7.

 

№ 55

Задание: Сумма коэффициентов перед окислителем и восстановителем в следующей ОВР равна: .

Ответы: 1) 6; 2) 4; 3) 12; 4) 8; 5) 10.

 

№ 56

Задание: Сумма коэффициентов перед окислителем и восстановителем в следующей ОВР NaClO3+SO2+H2SO4→ NaHSO4+ClO2 равна:

Ответы: 1) 3; 2) 6; 3) 8; 4) 10; 5) 12.

 

№ 57

Задание: Сумма коэффициентов перед окислителем и восстановителем в следующей ОВР равна:

Ответы: 1) 5; 2) 6; 3) 10; 4) 12; 5) 14.

 

№ 58

Задание: Коэффициент перед восстановителем в реакции

KMnO4+N2H4+H2SO4→ N2+ 4MnSO4+ K2SO4+H2O равен:

Ответы: 1) 5; 2) 7; 3) 8; 4) 10; 5) 9.

 

№ 59

Задание: Коэффициент перед восстановителем в реакции Na2S2O3+I2→Nа2S4O6+NaI равен:

Ответы: 1) 2; 2) 4; 3) 3; 4) 6; 5) 3.

 

№ 60

Задание: Сумма коэффициентов в правой части уравнения реакции

HgCl2+H3PO3+H2O→H3PO4+Hg+HCl равна:

Ответы: 1) 4; 2) 6; 3) 7; 4) 9; 5) 10.

 

№ 61

Задание: Сумма коэффициентов в уравнении реакции

Sb+HNO3→HsbO3+NO+H2O равна:

Ответы: 1) 13; 2) 15; 3) 17; 4) 18; 5) 20.

 

№ 62

Задание: Сумма коэффициентов в уравнении реакции

Sn+HNO3→H2SnO3+NO2+H2O равна:

α-оловянная кислота

Ответы: 1) 10; 2) 11; 3) 12; 4) 14; 5) 16.

 

№ 63

Задание: Сумма коэффициентов в уравнении ОВР равна: Na2RuO4+H2SO4→Na2SO4+RuO2+O2+H2O

Ответы: 1) 9; 2) 12; 3) 16; 4) 11; 5) 14.

 

№ 64

Задание: Реакция диспропорционирования следующая:

1) S + KOH → K2S + K2SO3 + H2O;

2) MgCl2+ H2O→MgОНCl+НCl;

3) 3Ag+4HNO3→3AgNO3+NO+2H2O ;

4) 2Cr(OH)3+3H2SO4→ Cr2(SO4)3+6H2O;

5) NaОН+НCl→NaCl+H2O.

Ответы:1); 2); 3); 4); 5).

 

№ 65

Задание: Реакция внутримолекулярного окисления-восстановления следующая:

1) 4Ag+H2S+O2→2Ag2S+2H2O;

2) 2СuI2→2CuI+I2;

3) 3K2MnO4+2H2O→2KMnO4+MnO2+4КОН;

4) 6NaОН+3S→ 2Na2S+Na2SO3+3H2O;

5) Сu+4HNO3→Cu(NO3)2 +2NO2+2H2O.

Ответы: 1); 2); 3); 4); 5).

 

№ 66

Задание: Окислительно-восстановительную двойственность проявляет:

1) ; 2) MnO2; 3)NO3¯; 4) NH3; 5) .

Ответы:1); 2); 3); 4); 5).

 

№ 67

Задание: Окислительно-восстановительную двойственность в реакциях проявляет следующая частица:

1) ; 2) NO2¯; 3) ; 4) Mn2+; 5) .

Ответы: 1); 2); 3); 4); 5).

 

№ 68

Задание: Окислительно-восстановительную двойственность в ОВР проявляет следующая частица:

1) NaCrO2; 2) NaNO3; 3) NH4NO3; 4) KMnO4; 5) Al.

Ответы: 1); 2); 3); 4); 5).

 

№ 69

Задание: Реакция диспропорционирования следующая:

1) Cl2 + NaOH → NaCl + NaClO + H2O;

2) MgCl2+ H2O→MgОНCl+НCl;

3) 3Ag+4HNO3→3AgNO3+NO+2H2O ;

4) Zn+2НCl→ZnCl2+H2 2Cr(OH)3+3H2SO4→ Cr2(SO4)3+6H2O;

5) MnO2 +4НCl→MnCl2+Cl2+2H2O.

Ответы: 1); 2); 3); 4); 5).

 

№ 70

Задание: K2Cr2O7 ( =1,33В) в кислой среде при стандартных условиях окислитель только для следующего процесса:

1) 2F--2ē=F2, φ0=2,85 B;

2) 2Cl--2ē=Cl2, φ0=1,36 В;

3) 2Br--2ē=Br 2, φ0=1,06 В;

4) Au3++3ē=Au0, φ0=1,5 В;

5) H2O2+2H+=2H2O, φ0=1,776 В.

Ответы:1); 2); 3); 4); 5).

 

№ 71

Задание: K2Cr2O7 ( =1,33В) в кислой среде при стандартных условиях окислитель только для следующего процесса:

1)

2)

3)

4)

5) .

Ответы: 1); 2); 3); 4); 5)

 

№ 72

Задание: Сложные ионы и молекулы, содержащие атомы в состоянии промежуточной степени окисления проявляют:

Ответы: 1) только восстановительные свойства; 2) только окислительные свойства; 3) не проявляют свойств окислителя и восстановителя; 4) проявляют свойства окислителя и восстановителя; 5) кислотные свойства.

Ответы: 1); 2); 3); 4); 5).

 

№ 73

Задание: В полуреакции: NH4+ число принятых электронов равно:

Ответы: 1) 10; 2) 8; 3) 12; 4) 14; 5) 9.

 

№ 74

Задание: В полуреакции: Сr3+→ CrO42- число отданных электронов равно:

Ответы: 1) 6; 2) 8; 3) 7; 4) 9; 5) 3.

 

№ 75

Задание: Окисление – это … степени окисления элемента (подберите правильное слово). В полуреакции P → PO43- степень окисления ванадия стала равной:

Ответы: 1) 8; 2) 4; 3) 5; 4) 6; 5) 10.

 

№ 76

Задание: Восстановление – это… степени окисления элемента (подберите правильное слово). В полуреакции MnO2 степень окисления марганца стала равной

Ответы: 1) 2; 2) 4; 3) 7; 4) 8; 5) 6.

 

№ 77

Задание: Только восстановителями в ОВР являются соединения:

1) Na2SnO3; 2) HIO4; 3) Na2S; 4) K2SO3; 5) Na3AsO4.

Ответы: 1); 2); 3); 4); 5).

 

№ 78

Задание: Только окислителями в ОВР являются соединения:

1) NaClO4; 2) H2SO3; 3) H2O2; 4) MnSO4; 5) Al.

Ответы: 1); 2); 3); 4); 5).

 

№ 79

Задание: Реакция окисления-восстановления следующая:

1) P2O5+3H2O→2H3PO4;

2) KОН+Al(OH)3→KAlO2+2H2O;

3) CaCO3→СаО+СO2;

4) SO3+H2O→H2SO4;

5) 2AgNO3→2Ag +2NO2+O2.

Ответы: 1); 2); 3); 4); 5).

 

№ 80

Задание: Только окислительные свойства проявляет следующая частица:

1) (NH4)2S2O8; 2) Na2SO3; 3) K2MnO4; 4) Al2(SO4)3; 5) HI.

Ответы: 1); 2); 3); 4); 5).

 

№ 81

Задание: Окислительно-восстановительная реакция следующая:

1) Sb+5HNO3+H2O→H[Sb(OH)6]+5NO2;

2) KОН+Al(OH)3→KAlO2+2H2O;

3) P2O5+3H2O→2H3PO4;

4) СrCl3+3H2O→ Cr(OH)3+3НСl;

5) NH3+H2O→NH4OH.

Ответы: 1); 2); 3); 4); 5).

 

№ 82

Задание: Масса (г) твердого продукта реакции между 9,8 л сероводорода и 17,5 л диоксида серы (н.у.) равна:

Ответы: 1) 20; 2) 18; 3) 21; 4) 24; 5) 22.

 

№ 83

Задание: Окислительно-восстановительный потенциал системы H2SO3+H2O→SO42-+4H++2ē, = 0,2B при следующих концентрациях H2SO3, SO42-, H+ (моль/л) соответственно 10-3, 5·10-2, 2,9 равен:

Ответы: 1) 0,19 В; 2) 0,38 В; 3) 0,22 В; 4) 0,4 В; 5) 0,18 В.

 

№ 84

Задание: Окислительно-восстановительный потенциал для системы

MnO4-+8H++5ē=Mn2++4H2O при условии ; равен:

Ответы: 1) 1,51В; 2) 1,49В; 3) 1,36В; 4) 1,47В; 5) 1,38В.

 

№ 85

Задание: Константа равновесия окислительно-восстановительной системы при стандартных условиях ; равна:

Ответы: 1) 2,63ּ1075; 2) 2,7ּ1070; 3) 2,4ּ1075; 4) 2,6ּ1070; 5) 2,65ּ1070.

 

№ 86

Задание: Направление окислительно-восстановительной реакции при указанных условиях будет:

1ּ10-4 1ּ10-6 1ּ10-2 1ּ10-2

моль/л моль/л моль/л моль/л

1) справа налево; 2) слева направо; 3) реакция находится в равновесии; 4) реакция ионообменная; 5) преобладает скорость прямой реакции.

Ответы: 1); 2); 3); 4); 5).

 

№ 87

Задание: Окислительно-восстановительная реакция 2Cо3++Pb2+↔2Cо2++Pb4+ при следующих концентрациях (моль/л): [Co3+], [Co2+], [Pb2+], [Pb4+] соответственно 1·10-4, 1·10-2, 1·10-6, 1·10-2 протекает:

1). справа налево; 2). слева направо; 3). ионообменная;

4) находится в равновесии; 5) не доходит до конца.

Ответы: 1); 2); 3); 4); 5).

 

№ 88

Задание: Окислительно-восстановительная реакция

6Br¯(p)+IO3¯(p)+6H+(p)=3Br2(ж)+I¯(p)+3H2O(ж) при следующих концентрациях (моль/л) [Br -], [Br2], [I-], [IO3-] соответственно 0,1; 1; 0,1; 0,001; а рН раствора равен 1, протекает:

1) Справа налево; 2) Слева направо; 3) Находится в равновесии;

4) Не протекает; 5) Доходит до конца при рН=2.

Ответы: 1); 2); 3); 4); 5).

 

№ 89

Задание: Окислительно-восстановительная реакция

6I-+Cr2O72-+14H+=2Cr3++3I3+7H2O

практически необратима, если значение константы равновесия таково: =1,33В,

Ответы: 1) 1,3·1081; 2) 2·1081; 3) 1,5·1079; 4) 1,3·1082; 5) 1,5·1081.

 

№ 90

Задание: Потенциал окислительно-восстановительной системы

6Fe2++ClO3-+6H+=Cl-+3H2O+6Fe2+ при рН=3,5 и концентрациях ионов Fe2+, ClO3¯, Cl¯, Fe3+ соответственно (моль/л) 10-2; 10-1; 1; 1,5 равен:

Ответы: 1) 0,6 B; 2) 0,591 B; 3) 0,78 B; 4) 0,62 B; 5) 0,599 B.

 

№ 91

Задание: Нормальность 10% (по массе) раствора KIO3 (ρ=1,052 г/мл) при восстановлении его до свободного йода равна:

Ответы: 1) 2,46 н; 2) 2,22 н; 3) 2,08 н; 4) 4,48 н; 5) 4,92 н.

 

№ 92

Задание: Константа равновесия реакции 2HNO3 + S = 2NO + H2SO4 при следующих условиях: Р=5,066·104 Па; CSO42-: Cs =10-6 : 1 моль/л; 10 моль/л равна:

Ответы: 1) 3,81ּ1059; 2) 3,60ּ1059; 3) 2,9ּ1029; 4) 3ּ1030; 5) 4ּ1059.

 

№ 93

Задание: Константа равновесия реакции

для стандартных условий равна:

Ответы: 1) 3,33·1029; 2) 3,22·1030; 3) 3,4·1030; 4) 3,5·1030%; 5) 3,6·1029.

 

№ 94

Задание: Окислительно-восстановительный потенциал пары Мn2+/Mn при

концентрации Mn2+=2 г-ион/л равен:

Ответы: 1) -1,171B; 2) -1,18В; 3) -2В; 4) -0,85В; 5) 1,2В.

 

№ 95

Задание: Окислительно-восстановительная реакция

H2S+H2SO4+K2Cr2O7→Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O

возможна, если Δφо реакции (j0Cr2O72-/2Cr3+ = 1,33 B; j0S0/S2- =+0,14 B) равна:

Ответы: 1) 0,56 В; 2) 1,21 В; 3) 0,7 В; 4) 0,8 В; 5) 0,82 В.

№ 96

Задание: Масса оксалата аммония (NH4)2C2O4, окисленная 50 мл 0,2 н раствора перманганата калия в кислой среде равна:

Ответы: 1) 1 г; 2) 0,5 г; 3) 0,62 г; 4) 1,24 г; 5) 1,2 г.

 

№ 97

Задание: Эквивалентная масса сероводорода в схеме реакции

H2S+4H2O=SO42-+10H++8ē равна:

Ответы: 1) 4,5 г/моль; 2) 4,25 г/моль; 3) 4,36 г/моль; 4) 3,8 г/моль;

5) 32 г/моль.

 

№ 98

Задание: Эквивалент и эквивалентная масса перхлората калия KClO4 при восстановлении его до диоксида хлора равны:

Ответы: 1) 1/2 моля; 46,2 г/моля; 2) 1/3 моля; 47,2 г/моля; 3) 1/3 г/моля;

46,2 г/моля; 4) 1/5 г/моля; 46,3 г/моля; 5) 1/4 моля; 46,2 г/моля.

 

№ 99

Задание: Эквивалент и эквивалентная масса перхлората калия KClO4 при восстановлении его до свободного хлора равны:

Ответы: 1) 1/7 моля; 19,8 г/моля; 2) 1/6 моля, 20,01 г/моль; 3) 1/3 моля;

19,8 г/моля; 4) 1/9 моля; 20,01 г/моля; 5) 1/4 моля; 19,8 г/моля.

 

№ 100

Задание: Эквивалент и эквивалентная масса перхлората калия KClO4 при восстановлении его до хлорид иона равны:

Ответы: 1) 1/9 г/моля; 17,3 г/моля; 2) 1/8 г/моля; 17,3 г/моля; 3) 1/6 г/моля;

18,2 г/моля; 4) 1/8 г/моля; 18,2 г/моля; 5) 1/8 моля; 20,2 г/моля.

 

№ 101

Задание: Число эквивалентов KI, необходимое для восстановления в кислой среде 1 моля K2Cr2O7, равно:

Ответы: 1) 5; 2) 6; 3) 8; 4) 7; 5) 8.

 

№ 102

Задание: Число эквивалентов KI, необходимое для восстановления в кислой среде 1 моля KMnO4, равно:

Ответы: 1) 5; 2) 8; 3) 6; 4) 4; 5) 10.

 

№ 103

Задание: Нормальность 0,1 М раствора перманганата калия, используемого для окисления сульфита натрия в кислой среде, равна:

Ответы: 1) 0,3 н; 2) 0,5 н; 3) 0,6 н; 4) 1 н; 5) 0,25 н.

 

№ 104

Задание: Нормальность 0,1 М раствора перманганата калия, используемого для окисления сульфида натрия в нейтральной среде, равна:

Ответы: 1) 0,5 н; 2) 0,3 н; 3) 0,2 н; 4) 0,4 н; 5) 0,8 н.

 

№ 105

Задание: Нормальность 0,1 М раствора перманганата калия, используемого для окисления сульфида натрия в щелочной среде, равна:

Ответы: 1) 0,2 н; 2) 0,1 н; 3) 0,4 н; 4) 0,6 н; 5) 0,48 н.

 

 

№ 106

Задание: Константа равновесия реакции MnO4-+5Fe2++8H+=Mn2++5Fe3++4H2O при стандартных условиях равна:

Ответы: 1) 1059; 2) 1063; 3) 1062; 4) 1064; 5) 1058.

 

 

№ 107

Задание: Константа равновесия окислительно-восстановительной реакции

10Br-+2MnO4-+16H+=5Br2+2Mn2++8H2O при стандартных условиях равна:

Ответы: 1) K=2,63·1075; 2) K=2,72·1075; 3) K=2,63·1076; 4) K=2,64·1075;

5) К=2,8·1075.

 

№ 108

Задание: Окислительно-восстановительную реакцию направляет:

1) ; 2) ; 3) ; 4) Δ ; 5) .

Ответы: 1); 2); 3); 4); 5).

 

№ 109

Задание: Окислительно-восстановительную реакцию направляет:

1) ΔG<0; 2) ΔφР<0; 3) температура не изменяется; 4) давление нормальное (101,3 кПа); 5) концентрации окисленной и восстановленной формы не изменяются.

Ответы: 1); 2); 3); 4); 5).

 

№ 110

Задание: Большая величина константы равновесия ОВР показывает, что равновесие смещено:

1) вправо; 2) влево; 3) концентрация восстановленной формы меньше концентрации окисленной формы; 4) скорость прямой реакции меньше скорости обратной; 5) скорость прямой реакции равна скорости обратной

Ответы: 1); 2); 3); 4); 5).

 

№ 111

Задание: Окислительно-восстановительная реакция

CrCl3+Br2+KOH→K2CrO4+KBr+H2O (j0CrO4-/Cr3+ = - 0,13 B; j0Br2/2Br- = 1,07 B) протекает слева направо, если ∆φо реакции равна:

Ответы: 1) 1,2В; 2) 2,4В; 3) 1,4В; 4) 2,6В; 5) 1,02В.

 

№ 112

Задание: Константа равновесия реакции

2KMnO4 + 5 HBr + 3 H2SO4 = 2 Mn SO4 + 5 HBrO + K2SO4 + 3 H2O

для стандартных условий равна:

Ответы: 1) 3,33ּ1029; 2) 3,22ּ1030; 3) 3,4ּ1030; 4) 3,5ּ1030; 5) 3,6ּ1029.

 

 

№ 113

Задание: Константа равновесия реакции, протекающей в кадмиево-цинковом гальваническом элементе, равна:

Ответы: 1) 1,6ּ1013; 2) 1,6ּ1012; 3) 1,6ּ10-12; 4) 1,6ּ1015; 5) 1,6ּ10-14.

 

ЛАБОРАТОРНЫЕ РАБОТЫ


Эта страница нарушает авторские права

allrefrs.ru - 2019 год. Все права принадлежат их авторам!